tributyl phosphite


tri-n-butyl phosphite; tributyl phosphite
Links:🕷 ChemSpider
CAS RN:[102-85-2]
Formula:C12H27O3P; 250.32 g/mol
InChiKey:XTTGYFREQJCEML-UHFFFAOYSA-N
SMILES:CCCCOP(OCCCC)OCCCC
Molecular structure of tributyl phosphite
Wiswesser LN:4OPO4&O4
Toxicology (LD50):3 000 mg/Kg (rat, or)
Density:0.915 g/mL
Molar volume:273.6 mL/mol
Refractive index:1.432
Molecular refractive power:70.96 mL/mol
Melting point:-80 °C

Isomers

dibutyl butylphosphonate
Molecular structure of dibutyl butylphosphonate
diethyl 1-octylphosphonate
Molecular structure of diethyl 1-octylphosphonate
dodecylphosphonic acid
Molecular structure of dodecylphosphonic acid
tributyl phosphite
Molecular structure of tributyl phosphite